C27H40F3N3O5 — CID 90694122
tert-butyl N-[(2S,3R)-1,3-dihydroxy-14-[4-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]tetradec-4-en-2-yl]carbamate (PubChem CID 90694122) has the molecular formula C27H40F3N3O5 and a molecular weight of 543.63 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-1,3-dihydroxy-14-[4-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]tetradec-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-1,3-dihydroxy-14-[4-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]tetradec-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 90694122 |
| Molecular Formula | C27H40F3N3O5 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | tert-butyl N-[(2S,3R)-1,3-dihydroxy-14-[4-[3-(trifluoromethyl)diazirin-3-yl]phenoxy]tetradec-4-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)[C@H](O)C=CCCCCCCCCCOc1ccc(C2(C(F)(F)F)N=N2)cc1 |
| InChI | InChI=1S/C27H40F3N3O5/c1-25(2,3)38-24(36)31-22(19-34)23(35)13-11-9-7-5-4-6-8-10-12-18-37-21-16-14-20(15-17-21)26(32-33-26)27(28,29)30/h11,13-17,22-23,34-35H,4-10,12,18-19H2,1-3H3,(H,31,36)/t22-,23+/m0/s1 |
| InChIKey | OPJSWAPXRIQTQK-XZOQPEGZSA-N |
| XLogP | 6.17 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|