C18H25NO6 — CID 56839830
[4-[(E,3S,4R)-3,5-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-1-enyl]phenyl] acetate (PubChem CID 56839830) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is [4-[(E,3S,4R)-3,5-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-1-enyl]phenyl] acetate.
| Compound Name | [4-[(E,3S,4R)-3,5-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 56839830 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | [4-[(E,3S,4R)-3,5-dihydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-1-enyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C/[C@H](O)[C@@H](CO)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H25NO6/c1-12(21)24-14-8-5-13(6-9-14)7-10-16(22)15(11-20)19-17(23)25-18(2,3)4/h5-10,15-16,20,22H,11H2,1-4H3,(H,19,23)/b10-7+/t15-,16+/m1/s1 |
| InChIKey | SJEBSLVWANFCCA-ZHANPKHBSA-N |
| XLogP | 1.87 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|