C21H31ClN2O6 — CID 118362103
tert-butyl N-[(E,3R)-5-(4-chlorophenyl)-1,3-dihydroxypent-4-en-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 118362103) has the molecular formula C21H31ClN2O6 and a molecular weight of 442.94 g/mol. Its IUPAC name is tert-butyl N-[(E,3R)-5-(4-chlorophenyl)-1,3-dihydroxypent-4-en-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-[(E,3R)-5-(4-chlorophenyl)-1,3-dihydroxypent-4-en-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 118362103 |
| Molecular Formula | C21H31ClN2O6 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | tert-butyl N-[(E,3R)-5-(4-chlorophenyl)-1,3-dihydroxypent-4-en-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)C(CO)[C@H](O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H31ClN2O6/c1-20(2,3)29-18(27)23-24(19(28)30-21(4,5)6)16(13-25)17(26)12-9-14-7-10-15(22)11-8-14/h7-12,16-17,25-26H,13H2,1-6H3,(H,23,27)/b12-9+/t16?,17-/m1/s1 |
| InChIKey | JUBGSXAWGLOLIX-APHVIGBPSA-N |
| XLogP | 3.75 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|