C21H33NO5 — CID 123419275
tert-butyl N-[1,3-dihydroxy-5-(4-pentoxyphenyl)pent-4-en-2-yl]carbamate (PubChem CID 123419275) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is tert-butyl N-[1,3-dihydroxy-5-(4-pentoxyphenyl)pent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1,3-dihydroxy-5-(4-pentoxyphenyl)pent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 123419275 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | tert-butyl N-[1,3-dihydroxy-5-(4-pentoxyphenyl)pent-4-en-2-yl]carbamate |
| SMILES | CCCCCOc1ccc(C=CC(O)C(CO)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H33NO5/c1-5-6-7-14-26-17-11-8-16(9-12-17)10-13-19(24)18(15-23)22-20(25)27-21(2,3)4/h8-13,18-19,23-24H,5-7,14-15H2,1-4H3,(H,22,25) |
| InChIKey | RYJKQBUNSLHKRH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|