C18H27NO4 — CID 10734555
N-[(E,2S,3R)-1,3-dihydroxy-5-(4-methoxyphenyl)pent-4-en-2-yl]hexanamide (PubChem CID 10734555) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[(E,2S,3R)-1,3-dihydroxy-5-(4-methoxyphenyl)pent-4-en-2-yl]hexanamide.
| Compound Name | N-[(E,2S,3R)-1,3-dihydroxy-5-(4-methoxyphenyl)pent-4-en-2-yl]hexanamide |
|---|---|
| PubChem CID | 10734555 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-[(E,2S,3R)-1,3-dihydroxy-5-(4-methoxyphenyl)pent-4-en-2-yl]hexanamide |
| SMILES | CCCCCC(=O)N[C@@H](CO)[C@H](O)/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H27NO4/c1-3-4-5-6-18(22)19-16(13-20)17(21)12-9-14-7-10-15(23-2)11-8-14/h7-12,16-17,20-21H,3-6,13H2,1-2H3,(H,19,22)/b12-9+/t16-,17+/m0/s1 |
| InChIKey | CMIJNSXIRPTSMF-GYPZGHTGSA-N |
| XLogP | 2.13 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|