C17H27NO3 — CID 59561748
(E,2R,3S)-2-(methylamino)-5-(4-pentoxyphenyl)pent-4-ene-1,3-diol (PubChem CID 59561748) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is (E,2R,3S)-2-(methylamino)-5-(4-pentoxyphenyl)pent-4-ene-1,3-diol.
| Compound Name | (E,2R,3S)-2-(methylamino)-5-(4-pentoxyphenyl)pent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 59561748 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | (E,2R,3S)-2-(methylamino)-5-(4-pentoxyphenyl)pent-4-ene-1,3-diol |
| SMILES | CCCCCOc1ccc(/C=C/[C@H](O)[C@@H](CO)NC)cc1 |
| InChI | InChI=1S/C17H27NO3/c1-3-4-5-12-21-15-9-6-14(7-10-15)8-11-17(20)16(13-19)18-2/h6-11,16-20H,3-5,12-13H2,1-2H3/b11-8+/t16-,17+/m1/s1 |
| InChIKey | UJAXCYIMLCSGBH-MXDRFRHJSA-N |
| XLogP | 2.21 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|