C26H44O2 — CID 144756784
10-[4-[(E,4S)-3,4-dimethyloct-1-enyl]phenoxy]decan-1-ol (PubChem CID 144756784) has the molecular formula C26H44O2 and a molecular weight of 388.64 g/mol. Its IUPAC name is 10-[4-[(E,4S)-3,4-dimethyloct-1-enyl]phenoxy]decan-1-ol.
| Compound Name | 10-[4-[(E,4S)-3,4-dimethyloct-1-enyl]phenoxy]decan-1-ol |
|---|---|
| PubChem CID | 144756784 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | 10-[4-[(E,4S)-3,4-dimethyloct-1-enyl]phenoxy]decan-1-ol |
| SMILES | CCCC[C@H](C)C(C)/C=C/c1ccc(OCCCCCCCCCCO)cc1 |
| InChI | InChI=1S/C26H44O2/c1-4-5-14-23(2)24(3)15-16-25-17-19-26(20-18-25)28-22-13-11-9-7-6-8-10-12-21-27/h15-20,23-24,27H,4-14,21-22H2,1-3H3/b16-15+/t23-,24?/m0/s1 |
| InChIKey | AHQKRGYNQKSAKY-ZFRPQTKASA-N |
| XLogP | 7.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|