C18H27NO3 — CID 91326925
N-[(2R,3S)-1,3-dihydroxy-5-(4-pentylphenyl)pent-4-en-2-yl]acetamide (PubChem CID 91326925) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-[(2R,3S)-1,3-dihydroxy-5-(4-pentylphenyl)pent-4-en-2-yl]acetamide.
| Compound Name | N-[(2R,3S)-1,3-dihydroxy-5-(4-pentylphenyl)pent-4-en-2-yl]acetamide |
|---|---|
| PubChem CID | 91326925 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | N-[(2R,3S)-1,3-dihydroxy-5-(4-pentylphenyl)pent-4-en-2-yl]acetamide |
| SMILES | CCCCCc1ccc(C=C[C@H](O)[C@@H](CO)NC(C)=O)cc1 |
| InChI | InChI=1S/C18H27NO3/c1-3-4-5-6-15-7-9-16(10-8-15)11-12-18(22)17(13-20)19-14(2)21/h7-12,17-18,20,22H,3-6,13H2,1-2H3,(H,19,21)/t17-,18+/m1/s1 |
| InChIKey | KKTBPYLCECKMNV-MSOLQXFVSA-N |
| XLogP | 2.29 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|