C18H27ClN2O3 — CID 142667075
1-[5-(4-chlorophenyl)-1,3-dihydroxypent-4-en-2-yl]-3-hexylurea (PubChem CID 142667075) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-1,3-dihydroxypent-4-en-2-yl]-3-hexylurea.
| Compound Name | 1-[5-(4-chlorophenyl)-1,3-dihydroxypent-4-en-2-yl]-3-hexylurea |
|---|---|
| PubChem CID | 142667075 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-1,3-dihydroxypent-4-en-2-yl]-3-hexylurea |
| SMILES | CCCCCCNC(=O)NC(CO)C(O)C=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H27ClN2O3/c1-2-3-4-5-12-20-18(24)21-16(13-22)17(23)11-8-14-6-9-15(19)10-7-14/h6-11,16-17,22-23H,2-5,12-13H2,1H3,(H2,20,21,24) |
| InChIKey | WAOLUSXXHPFMKT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|