C16H24N2O2S — CID 142667039
1-butyl-3-(1,3-dihydroxy-5-phenylpent-4-en-2-yl)thiourea (PubChem CID 142667039) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 1-butyl-3-(1,3-dihydroxy-5-phenylpent-4-en-2-yl)thiourea.
| Compound Name | 1-butyl-3-(1,3-dihydroxy-5-phenylpent-4-en-2-yl)thiourea |
|---|---|
| PubChem CID | 142667039 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-butyl-3-(1,3-dihydroxy-5-phenylpent-4-en-2-yl)thiourea |
| SMILES | CCCCNC(=S)NC(CO)C(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C16H24N2O2S/c1-2-3-11-17-16(21)18-14(12-19)15(20)10-9-13-7-5-4-6-8-13/h4-10,14-15,19-20H,2-3,11-12H2,1H3,(H2,17,18,21) |
| InChIKey | GKIKAKHTQMRBPY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|