C18H28N2O3 — CID 142667053
1-(1,3-dihydroxy-5-phenylpent-4-en-2-yl)-3-hexylurea (PubChem CID 142667053) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 1-(1,3-dihydroxy-5-phenylpent-4-en-2-yl)-3-hexylurea.
| Compound Name | 1-(1,3-dihydroxy-5-phenylpent-4-en-2-yl)-3-hexylurea |
|---|---|
| PubChem CID | 142667053 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 1-(1,3-dihydroxy-5-phenylpent-4-en-2-yl)-3-hexylurea |
| SMILES | CCCCCCNC(=O)NC(CO)C(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C18H28N2O3/c1-2-3-4-8-13-19-18(23)20-16(14-21)17(22)12-11-15-9-6-5-7-10-15/h5-7,9-12,16-17,21-22H,2-4,8,13-14H2,1H3,(H2,19,20,23) |
| InChIKey | AYBSOLUIAHSCOH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|