C19H21NO3 — CID 118714809
N-[(E,2S,3R)-1,3-dihydroxy-5-(4-phenylphenyl)pent-4-en-2-yl]acetamide (PubChem CID 118714809) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is N-[(E,2S,3R)-1,3-dihydroxy-5-(4-phenylphenyl)pent-4-en-2-yl]acetamide.
| Compound Name | N-[(E,2S,3R)-1,3-dihydroxy-5-(4-phenylphenyl)pent-4-en-2-yl]acetamide |
|---|---|
| PubChem CID | 118714809 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-[(E,2S,3R)-1,3-dihydroxy-5-(4-phenylphenyl)pent-4-en-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](CO)[C@H](O)/C=C/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H21NO3/c1-14(22)20-18(13-21)19(23)12-9-15-7-10-17(11-8-15)16-5-3-2-4-6-16/h2-12,18-19,21,23H,13H2,1H3,(H,20,22)/b12-9+/t18-,19+/m0/s1 |
| InChIKey | RWJPFAJZRWOANF-MLQCUJFCSA-N |
| XLogP | 2.22 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |