C17H26N4O5 — CID 139311785
tert-butyl N-[(2R)-1-[2-[formyl(methyl)amino]-4-(hydrazinecarbonyl)phenoxy]propan-2-yl]carbamate (PubChem CID 139311785) has the molecular formula C17H26N4O5 and a molecular weight of 366.42 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[2-[formyl(methyl)amino]-4-(hydrazinecarbonyl)phenoxy]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[2-[formyl(methyl)amino]-4-(hydrazinecarbonyl)phenoxy]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 139311785 |
| Molecular Formula | C17H26N4O5 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | tert-butyl N-[(2R)-1-[2-[formyl(methyl)amino]-4-(hydrazinecarbonyl)phenoxy]propan-2-yl]carbamate |
| SMILES | C[C@H](COc1ccc(C(=O)NN)cc1N(C)C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26N4O5/c1-11(19-16(24)26-17(2,3)4)9-25-14-7-6-12(15(23)20-18)8-13(14)21(5)10-22/h6-8,10-11H,9,18H2,1-5H3,(H,19,24)(H,20,23)/t11-/m1/s1 |
| InChIKey | VDOZOYZKJIXWQG-LLVKDONJSA-N |
| XLogP | 1.17 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|