C20H28ClNO5 — CID 66935344
(2Z)-2-[(2-butoxy-5-chlorophenyl)methylidene]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 66935344) has the molecular formula C20H28ClNO5 and a molecular weight of 397.90 g/mol. Its IUPAC name is (2Z)-2-[(2-butoxy-5-chlorophenyl)methylidene]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (2Z)-2-[(2-butoxy-5-chlorophenyl)methylidene]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 66935344 |
| Molecular Formula | C20H28ClNO5 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (2Z)-2-[(2-butoxy-5-chlorophenyl)methylidene]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CCCCOc1ccc(Cl)cc1/C=C(/CCNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C20H28ClNO5/c1-5-6-11-26-17-8-7-16(21)13-15(17)12-14(18(23)24)9-10-22-19(25)27-20(2,3)4/h7-8,12-13H,5-6,9-11H2,1-4H3,(H,22,25)(H,23,24)/b14-12- |
| InChIKey | JWCUFULHTVEQCI-OWBHPGMISA-N |
| XLogP | 4.90 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|