C13H11ClF3NO4 — CID 91209967
3-(5-chloro-2-methoxyphenyl)-2-[[(2,2,2-trifluoroacetyl)amino]methyl]prop-2-enoic acid (PubChem CID 91209967) has the molecular formula C13H11ClF3NO4 and a molecular weight of 337.68 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-2-[[(2,2,2-trifluoroacetyl)amino]methyl]prop-2-enoic acid.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-2-[[(2,2,2-trifluoroacetyl)amino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 91209967 |
| Molecular Formula | C13H11ClF3NO4 |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-2-[[(2,2,2-trifluoroacetyl)amino]methyl]prop-2-enoic acid |
| SMILES | COc1ccc(Cl)cc1C=C(CNC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H11ClF3NO4/c1-22-10-3-2-9(14)5-7(10)4-8(11(19)20)6-18-12(21)13(15,16)17/h2-5H,6H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | GRHUYWICBRYEGB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|