C14H13ClF3NO4 — CID 123818408
3-(5-chloro-2-methoxyphenyl)-2-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]prop-2-enoic acid (PubChem CID 123818408) has the molecular formula C14H13ClF3NO4 and a molecular weight of 351.71 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-2-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]prop-2-enoic acid.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-2-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123818408 |
| Molecular Formula | C14H13ClF3NO4 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-2-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]prop-2-enoic acid |
| SMILES | COc1ccc(Cl)cc1C=C(CN(C)C(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C14H13ClF3NO4/c1-19(13(22)14(16,17)18)7-9(12(20)21)5-8-6-10(15)3-4-11(8)23-2/h3-6H,7H2,1-2H3,(H,20,21) |
| InChIKey | ZDIBHCFPARWFPO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|