C25H29N7O5 — CID 67660729
3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl 3-(1H-indazole-5-carbonylamino)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 67660729) has the molecular formula C25H29N7O5 and a molecular weight of 507.55 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl 3-(1H-indazole-5-carbonylamino)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl 3-(1H-indazole-5-carbonylamino)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 67660729 |
| Molecular Formula | C25H29N7O5 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-ylamino)propyl 3-(1H-indazole-5-carbonylamino)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | O=C(NC(CNC(=O)c1ccc2[nH]ncc2c1)C(=O)OCCCNC1=NCCN1)OCc1ccccc1 |
| InChI | InChI=1S/C25H29N7O5/c33-22(18-7-8-20-19(13-18)14-30-32-20)29-15-21(31-25(35)37-16-17-5-2-1-3-6-17)23(34)36-12-4-9-26-24-27-10-11-28-24/h1-3,5-8,13-14,21H,4,9-12,15-16H2,(H,29,33)(H,30,32)(H,31,35)(H2,26,27,28) |
| InChIKey | OMMZSBVCDSBJDL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 158.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|