C23H26N4O3 — CID 90771041
benzyl N-[4-(1H-indazole-5-carbonylamino)cyclohexyl]-N-methylcarbamate (PubChem CID 90771041) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is benzyl N-[4-(1H-indazole-5-carbonylamino)cyclohexyl]-N-methylcarbamate.
| Compound Name | benzyl N-[4-(1H-indazole-5-carbonylamino)cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 90771041 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | benzyl N-[4-(1H-indazole-5-carbonylamino)cyclohexyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCc1ccccc1)C1CCC(NC(=O)c2ccc3[nH]ncc3c2)CC1 |
| InChI | InChI=1S/C23H26N4O3/c1-27(23(29)30-15-16-5-3-2-4-6-16)20-10-8-19(9-11-20)25-22(28)17-7-12-21-18(13-17)14-24-26-21/h2-7,12-14,19-20H,8-11,15H2,1H3,(H,24,26)(H,25,28) |
| InChIKey | WMTZZDPLDSNCNL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |