C14H24Cl2N4O — CID 119874720
N-[4-(pyridin-2-ylamino)butyl]pyrrolidine-3-carboxamide;dihydrochloride (PubChem CID 119874720) has the molecular formula C14H24Cl2N4O and a molecular weight of 335.28 g/mol. Its IUPAC name is N-[4-(pyridin-2-ylamino)butyl]pyrrolidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[4-(pyridin-2-ylamino)butyl]pyrrolidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119874720 |
| Molecular Formula | C14H24Cl2N4O |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-[4-(pyridin-2-ylamino)butyl]pyrrolidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCCNc1ccccn1)C1CCNC1 |
| InChI | InChI=1S/C14H22N4O.2ClH/c19-14(12-6-10-15-11-12)18-9-4-3-8-17-13-5-1-2-7-16-13;;/h1-2,5,7,12,15H,3-4,6,8-11H2,(H,16,17)(H,18,19);2*1H |
| InChIKey | QXDUJJCEMMIZIQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|