C18H28N4O — CID 119874683
N-[4-(pyridin-2-ylamino)butyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119874683) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is N-[4-(pyridin-2-ylamino)butyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[4-(pyridin-2-ylamino)butyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119874683 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | N-[4-(pyridin-2-ylamino)butyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | O=C(NCCCCNc1ccccn1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C18H28N4O/c23-18(16-13-14-7-1-2-8-15(14)22-16)21-12-6-5-11-20-17-9-3-4-10-19-17/h3-4,9-10,14-16,22H,1-2,5-8,11-13H2,(H,19,20)(H,21,23) |
| InChIKey | GOHXIFISNUHFNK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|