C24H27N3O5S — CID 11202207
3-phenyl-3-[[3-[4-(pyridin-2-ylamino)butoxy]phenyl]sulfonylamino]propanoic acid (PubChem CID 11202207) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is 3-phenyl-3-[[3-[4-(pyridin-2-ylamino)butoxy]phenyl]sulfonylamino]propanoic acid.
| Compound Name | 3-phenyl-3-[[3-[4-(pyridin-2-ylamino)butoxy]phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 11202207 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 3-phenyl-3-[[3-[4-(pyridin-2-ylamino)butoxy]phenyl]sulfonylamino]propanoic acid |
| SMILES | O=C(O)CC(NS(=O)(=O)c1cccc(OCCCCNc2ccccn2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H27N3O5S/c28-24(29)18-22(19-9-2-1-3-10-19)27-33(30,31)21-12-8-11-20(17-21)32-16-7-6-15-26-23-13-4-5-14-25-23/h1-5,8-14,17,22,27H,6-7,15-16,18H2,(H,25,26)(H,28,29) |
| InChIKey | ATSOANARHNGMHI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|