C25H27FN2O3 — CID 139943222
3-(4-fluorophenyl)-4-[4-[4-(pyridin-2-ylamino)butoxy]phenyl]butanoic acid (PubChem CID 139943222) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-[4-[4-(pyridin-2-ylamino)butoxy]phenyl]butanoic acid.
| Compound Name | 3-(4-fluorophenyl)-4-[4-[4-(pyridin-2-ylamino)butoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 139943222 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-(4-fluorophenyl)-4-[4-[4-(pyridin-2-ylamino)butoxy]phenyl]butanoic acid |
| SMILES | O=C(O)CC(Cc1ccc(OCCCCNc2ccccn2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H27FN2O3/c26-22-10-8-20(9-11-22)21(18-25(29)30)17-19-6-12-23(13-7-19)31-16-4-3-15-28-24-5-1-2-14-27-24/h1-2,5-14,21H,3-4,15-18H2,(H,27,28)(H,29,30) |
| InChIKey | IDUHVOQZJNBZQL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|