C28H28N2O3 — CID 142045132
3-naphthalen-2-yl-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid (PubChem CID 142045132) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is 3-naphthalen-2-yl-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid.
| Compound Name | 3-naphthalen-2-yl-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 142045132 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 3-naphthalen-2-yl-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid |
| SMILES | O=C(O)CC(Cc1ccc(OCCCNc2ccccn2)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H28N2O3/c31-28(32)20-25(24-12-11-22-6-1-2-7-23(22)19-24)18-21-9-13-26(14-10-21)33-17-5-16-30-27-8-3-4-15-29-27/h1-4,6-15,19,25H,5,16-18,20H2,(H,29,30)(H,31,32) |
| InChIKey | JJHCCVDELSSECX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|