C26H29N3O3 — CID 158690897
methane;(3S)-3-phenyl-3-[6-[3-(pyridin-2-ylamino)propoxy]-1H-indol-3-yl]propanoic acid (PubChem CID 158690897) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is methane;(3S)-3-phenyl-3-[6-[3-(pyridin-2-ylamino)propoxy]-1H-indol-3-yl]propanoic acid.
| Compound Name | methane;(3S)-3-phenyl-3-[6-[3-(pyridin-2-ylamino)propoxy]-1H-indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 158690897 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | methane;(3S)-3-phenyl-3-[6-[3-(pyridin-2-ylamino)propoxy]-1H-indol-3-yl]propanoic acid |
| SMILES | C.O=C(O)C[C@@H](c1ccccc1)c1c[nH]c2cc(OCCCNc3ccccn3)ccc12 |
| InChI | InChI=1S/C25H25N3O3.CH4/c29-25(30)16-21(18-7-2-1-3-8-18)22-17-28-23-15-19(10-11-20(22)23)31-14-6-13-27-24-9-4-5-12-26-24;/h1-5,7-12,15,17,21,28H,6,13-14,16H2,(H,26,27)(H,29,30);1H4/t21-;/m0./s1 |
| InChIKey | IGIIEJWRJGMGQE-BOXHHOBZSA-N |
| XLogP | 5.69 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|