C23H25FN4O3 — CID 22714445
3-[6-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propoxy]-1H-indol-3-yl]-3-(4-fluorophenyl)propanoic acid (PubChem CID 22714445) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is 3-[6-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propoxy]-1H-indol-3-yl]-3-(4-fluorophenyl)propanoic acid.
| Compound Name | 3-[6-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propoxy]-1H-indol-3-yl]-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 22714445 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3-[6-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propoxy]-1H-indol-3-yl]-3-(4-fluorophenyl)propanoic acid |
| SMILES | O=C(O)CC(c1ccc(F)cc1)c1c[nH]c2cc(OCCCNC3=NCCN3)ccc12 |
| InChI | InChI=1S/C23H25FN4O3/c24-16-4-2-15(3-5-16)19(13-22(29)30)20-14-28-21-12-17(6-7-18(20)21)31-11-1-8-25-23-26-9-10-27-23/h2-7,12,14,19,28H,1,8-11,13H2,(H,29,30)(H2,25,26,27) |
| InChIKey | VZLAWLMHLKDXOG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|