C28H23N3O5 — CID 10277559
3-[6-[3-(1H-indol-2-ylamino)-2,3-dioxopropoxy]-1H-indol-3-yl]-3-phenylpropanoic acid (PubChem CID 10277559) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is 3-[6-[3-(1H-indol-2-ylamino)-2,3-dioxopropoxy]-1H-indol-3-yl]-3-phenylpropanoic acid.
| Compound Name | 3-[6-[3-(1H-indol-2-ylamino)-2,3-dioxopropoxy]-1H-indol-3-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 10277559 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 3-[6-[3-(1H-indol-2-ylamino)-2,3-dioxopropoxy]-1H-indol-3-yl]-3-phenylpropanoic acid |
| SMILES | O=C(O)CC(c1ccccc1)c1c[nH]c2cc(OCC(=O)C(=O)Nc3cc4ccccc4[nH]3)ccc12 |
| InChI | InChI=1S/C28H23N3O5/c32-25(28(35)31-26-12-18-8-4-5-9-23(18)30-26)16-36-19-10-11-20-22(15-29-24(20)13-19)21(14-27(33)34)17-6-2-1-3-7-17/h1-13,15,21,29-30H,14,16H2,(H,31,35)(H,33,34) |
| InChIKey | JIIPCSYTJUENLR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|