C25H33N3O3 — CID 86586121
ethyl (3S)-3-phenyl-4-[4-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propoxy]phenyl]butanoate (PubChem CID 86586121) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is ethyl (3S)-3-phenyl-4-[4-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propoxy]phenyl]butanoate.
| Compound Name | ethyl (3S)-3-phenyl-4-[4-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propoxy]phenyl]butanoate |
|---|---|
| PubChem CID | 86586121 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | ethyl (3S)-3-phenyl-4-[4-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propoxy]phenyl]butanoate |
| SMILES | CCOC(=O)C[C@H](Cc1ccc(OCCCNC2=NCCCN2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H33N3O3/c1-2-30-24(29)19-22(21-8-4-3-5-9-21)18-20-10-12-23(13-11-20)31-17-7-16-28-25-26-14-6-15-27-25/h3-5,8-13,22H,2,6-7,14-19H2,1H3,(H2,26,27,28)/t22-/m0/s1 |
| InChIKey | JDBFFDMLFBIDJU-QFIPXVFZSA-N |
| XLogP | 3.67 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|