C22H28N4O6 — CID 59988681
ethyl 3-(1,3-benzodioxol-5-yl)-4-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propoxy]-1,2-oxazol-5-yl]butanoate (PubChem CID 59988681) has the molecular formula C22H28N4O6 and a molecular weight of 444.49 g/mol. Its IUPAC name is ethyl 3-(1,3-benzodioxol-5-yl)-4-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propoxy]-1,2-oxazol-5-yl]butanoate.
| Compound Name | ethyl 3-(1,3-benzodioxol-5-yl)-4-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propoxy]-1,2-oxazol-5-yl]butanoate |
|---|---|
| PubChem CID | 59988681 |
| Molecular Formula | C22H28N4O6 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | ethyl 3-(1,3-benzodioxol-5-yl)-4-[3-[3-(4,5-dihydro-1H-imidazol-2-ylamino)propoxy]-1,2-oxazol-5-yl]butanoate |
| SMILES | CCOC(=O)CC(Cc1cc(OCCCNC2=NCCN2)no1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H28N4O6/c1-2-28-21(27)12-16(15-4-5-18-19(11-15)31-14-30-18)10-17-13-20(26-32-17)29-9-3-6-23-22-24-7-8-25-22/h4-5,11,13,16H,2-3,6-10,12,14H2,1H3,(H2,23,24,25) |
| InChIKey | NXRVJVXGFXHCRL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|