C35H41NO5SSi — CID 21059942
ethyl 3-(1,3-benzodioxol-5-yl)-4-[2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-1,3-thiazol-4-yl]butanoate (PubChem CID 21059942) has the molecular formula C35H41NO5SSi and a molecular weight of 615.87 g/mol. Its IUPAC name is ethyl 3-(1,3-benzodioxol-5-yl)-4-[2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-1,3-thiazol-4-yl]butanoate.
| Compound Name | ethyl 3-(1,3-benzodioxol-5-yl)-4-[2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-1,3-thiazol-4-yl]butanoate |
|---|---|
| PubChem CID | 21059942 |
| Molecular Formula | C35H41NO5SSi |
| Molecular Weight | 615.87 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | ethyl 3-(1,3-benzodioxol-5-yl)-4-[2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-1,3-thiazol-4-yl]butanoate |
| SMILES | CCOC(=O)CC(Cc1csc(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)n1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C35H41NO5SSi/c1-5-38-34(37)23-27(26-18-19-31-32(22-26)40-25-39-31)21-28-24-42-33(36-28)17-12-20-41-43(35(2,3)4,29-13-8-6-9-14-29)30-15-10-7-11-16-30/h6-11,13-16,18-19,22,24,27H,5,12,17,20-21,23,25H2,1-4H3 |
| InChIKey | DQYUQHVVULIJGQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.87 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|