C36H52O5Si2 — CID 101253763
(2S,3R)-3-(1,3-benzodioxol-5-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-tri(propan-2-yl)silyloxypropan-1-ol (PubChem CID 101253763) has the molecular formula C36H52O5Si2 and a molecular weight of 620.98 g/mol. Its IUPAC name is (2S,3R)-3-(1,3-benzodioxol-5-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-tri(propan-2-yl)silyloxypropan-1-ol.
| Compound Name | (2S,3R)-3-(1,3-benzodioxol-5-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-tri(propan-2-yl)silyloxypropan-1-ol |
|---|---|
| PubChem CID | 101253763 |
| Molecular Formula | C36H52O5Si2 |
| Molecular Weight | 620.98 g/mol |
| Exact Mass | 620.34 |
| IUPAC Name | (2S,3R)-3-(1,3-benzodioxol-5-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-tri(propan-2-yl)silyloxypropan-1-ol |
| SMILES | CC(C)[Si](O[C@@H](c1ccc2c(c1)OCO2)[C@@H](CO)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H52O5Si2/c1-26(2)42(27(3)4,28(5)6)41-35(29-20-21-33-34(22-29)39-25-38-33)30(23-37)24-40-43(36(7,8)9,31-16-12-10-13-17-31)32-18-14-11-15-19-32/h10-22,26-28,30,35,37H,23-25H2,1-9H3/t30-,35-/m0/s1 |
| InChIKey | NHIVVZMCSBQZSG-QGRQJHSQSA-N |
| XLogP | 7.83 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.98 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|