C20H24N2O6 — CID 59988780
ethyl 3-(1,3-benzodioxol-5-yl)-4-[3-(5-oxopentyl)-1,2,4-oxadiazol-5-yl]butanoate (PubChem CID 59988780) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is ethyl 3-(1,3-benzodioxol-5-yl)-4-[3-(5-oxopentyl)-1,2,4-oxadiazol-5-yl]butanoate.
| Compound Name | ethyl 3-(1,3-benzodioxol-5-yl)-4-[3-(5-oxopentyl)-1,2,4-oxadiazol-5-yl]butanoate |
|---|---|
| PubChem CID | 59988780 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | ethyl 3-(1,3-benzodioxol-5-yl)-4-[3-(5-oxopentyl)-1,2,4-oxadiazol-5-yl]butanoate |
| SMILES | CCOC(=O)CC(Cc1nc(CCCCC=O)no1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H24N2O6/c1-2-25-20(24)12-15(14-7-8-16-17(10-14)27-13-26-16)11-19-21-18(22-28-19)6-4-3-5-9-23/h7-10,15H,2-6,11-13H2,1H3 |
| InChIKey | ULZQJBOWFAOMPU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|