C20H23BN2O7 — CID 59988720
CID 59988720 (PubChem CID 59988720) has the molecular formula C20H23BN2O7 and a molecular weight of 414.22 g/mol.
| Compound Name | CID 59988720 |
|---|---|
| PubChem CID | 59988720 |
| Molecular Formula | C20H23BN2O7 |
| Molecular Weight | 414.22 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NCCCOc1cc(CC(CC(=O)OCC)c2ccc3c(c2)OCO3)on1 |
| InChI | InChI=1S/C20H23BN2O7/c1-2-26-19(24)10-14(13-4-5-16-17(9-13)29-12-28-16)8-15-11-18(23-30-15)27-7-3-6-22-20(21)25/h4-5,9,11,14H,2-3,6-8,10,12H2,1H3,(H,22,25) |
| InChIKey | MHJDOONNTXMKSF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|