C26H33N3O7 — CID 142918081
ethyl (Z)-7-amino-3-(1,3-benzodioxol-5-yl)-5-hydroxy-7-oxohept-5-enoate;7-ethyl-2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepine (PubChem CID 142918081) has the molecular formula C26H33N3O7 and a molecular weight of 499.56 g/mol. Its IUPAC name is ethyl (Z)-7-amino-3-(1,3-benzodioxol-5-yl)-5-hydroxy-7-oxohept-5-enoate;7-ethyl-2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepine.
| Compound Name | ethyl (Z)-7-amino-3-(1,3-benzodioxol-5-yl)-5-hydroxy-7-oxohept-5-enoate;7-ethyl-2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepine |
|---|---|
| PubChem CID | 142918081 |
| Molecular Formula | C26H33N3O7 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | ethyl (Z)-7-amino-3-(1,3-benzodioxol-5-yl)-5-hydroxy-7-oxohept-5-enoate;7-ethyl-2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepine |
| SMILES | CCOC(=O)CC(C/C(O)=C/C(N)=O)c1ccc2c(c1)OCO2.CCc1ccc2c(n1)NCCCO2 |
| InChI | InChI=1S/C16H19NO6.C10H14N2O/c1-2-21-16(20)7-11(5-12(18)8-15(17)19)10-3-4-13-14(6-10)23-9-22-13;1-2-8-4-5-9-10(12-8)11-6-3-7-13-9/h3-4,6,8,11,18H,2,5,7,9H2,1H3,(H2,17,19);4-5H,2-3,6-7H2,1H3,(H,11,12)/b12-8-; |
| InChIKey | OEMTVOPJFLUHBL-JCTPKUEWSA-N |
| XLogP | 3.61 |
| TPSA | 142.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|