C24H27N3O7 — CID 142918041
(Z)-3-(1,3-benzodioxol-5-yl)-5-hydroxy-7-oxo-7-[2-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepin-7-yl)ethylamino]hept-5-enoic acid (PubChem CID 142918041) has the molecular formula C24H27N3O7 and a molecular weight of 469.49 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-yl)-5-hydroxy-7-oxo-7-[2-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepin-7-yl)ethylamino]hept-5-enoic acid.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-yl)-5-hydroxy-7-oxo-7-[2-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepin-7-yl)ethylamino]hept-5-enoic acid |
|---|---|
| PubChem CID | 142918041 |
| Molecular Formula | C24H27N3O7 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-5-hydroxy-7-oxo-7-[2-(2,3,4,5-tetrahydropyrido[3,2-b][1,4]oxazepin-7-yl)ethylamino]hept-5-enoic acid |
| SMILES | O=C(O)CC(C/C(O)=C/C(=O)NCCc1ccc2c(n1)NCCCO2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H27N3O7/c28-18(10-16(12-23(30)31)15-2-4-19-21(11-15)34-14-33-19)13-22(29)25-8-6-17-3-5-20-24(27-17)26-7-1-9-32-20/h2-5,11,13,16,28H,1,6-10,12,14H2,(H,25,29)(H,26,27)(H,30,31)/b18-13- |
| InChIKey | FDOREYWTFCRRFV-AQTBWJFISA-N |
| XLogP | 2.75 |
| TPSA | 139.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|