C30H39N3O4 — CID 142868490
methyl 3-(2,3-dihydro-1-benzofuran-6-yl)-4-[1-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoyl]piperidin-4-yl]butanoate (PubChem CID 142868490) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is methyl 3-(2,3-dihydro-1-benzofuran-6-yl)-4-[1-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoyl]piperidin-4-yl]butanoate.
| Compound Name | methyl 3-(2,3-dihydro-1-benzofuran-6-yl)-4-[1-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoyl]piperidin-4-yl]butanoate |
|---|---|
| PubChem CID | 142868490 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | methyl 3-(2,3-dihydro-1-benzofuran-6-yl)-4-[1-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoyl]piperidin-4-yl]butanoate |
| SMILES | COC(=O)CC(CC1CCN(C(=O)CCCc2ccc3c(n2)NCCC3)CC1)c1ccc2c(c1)OCC2 |
| InChI | InChI=1S/C30H39N3O4/c1-36-29(35)20-25(24-8-7-22-13-17-37-27(22)19-24)18-21-11-15-33(16-12-21)28(34)6-2-5-26-10-9-23-4-3-14-31-30(23)32-26/h7-10,19,21,25H,2-6,11-18,20H2,1H3,(H,31,32) |
| InChIKey | BPWSRVFRPZHPQE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |