C33H45N3O7S — CID 87453923
3-[4-[2-(2-acetylsulfanylethoxy)ethoxy]-3-methoxyphenyl]-4-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoyl]piperidin-4-yl]butanoic acid (PubChem CID 87453923) has the molecular formula C33H45N3O7S and a molecular weight of 627.80 g/mol. Its IUPAC name is 3-[4-[2-(2-acetylsulfanylethoxy)ethoxy]-3-methoxyphenyl]-4-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoyl]piperidin-4-yl]butanoic acid.
| Compound Name | 3-[4-[2-(2-acetylsulfanylethoxy)ethoxy]-3-methoxyphenyl]-4-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoyl]piperidin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 87453923 |
| Molecular Formula | C33H45N3O7S |
| Molecular Weight | 627.80 g/mol |
| Exact Mass | 627.30 |
| IUPAC Name | 3-[4-[2-(2-acetylsulfanylethoxy)ethoxy]-3-methoxyphenyl]-4-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoyl]piperidin-4-yl]butanoic acid |
| SMILES | COc1cc(C(CC(=O)O)CC2CCN(C(=O)CCc3ccc4c(n3)NCCC4)CC2)ccc1OCCOCCSC(C)=O |
| InChI | InChI=1S/C33H45N3O7S/c1-23(37)44-19-18-42-16-17-43-29-9-6-26(21-30(29)41-2)27(22-32(39)40)20-24-11-14-36(15-12-24)31(38)10-8-28-7-5-25-4-3-13-34-33(25)35-28/h5-7,9,21,24,27H,3-4,8,10-20,22H2,1-2H3,(H,34,35)(H,39,40) |
| InChIKey | ADFLCSYEPITRCB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.80 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|