C29H41N3O4 — CID 138542791
3-[3-(2-propan-2-yloxyethoxy)phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid (PubChem CID 138542791) has the molecular formula C29H41N3O4 and a molecular weight of 495.66 g/mol. Its IUPAC name is 3-[3-(2-propan-2-yloxyethoxy)phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid.
| Compound Name | 3-[3-(2-propan-2-yloxyethoxy)phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 138542791 |
| Molecular Formula | C29H41N3O4 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | 3-[3-(2-propan-2-yloxyethoxy)phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid |
| SMILES | CC(C)OCCOc1cccc(C(CC(=O)O)CN2CC[C@@H](CCc3ccc4c(n3)NCCC4)C2)c1 |
| InChI | InChI=1S/C29H41N3O4/c1-21(2)35-15-16-36-27-7-3-5-24(17-27)25(18-28(33)34)20-32-14-12-22(19-32)8-10-26-11-9-23-6-4-13-30-29(23)31-26/h3,5,7,9,11,17,21-22,25H,4,6,8,10,12-16,18-20H2,1-2H3,(H,30,31)(H,33,34)/t22-,25?/m1/s1 |
| InChIKey | JMDJWCPDMOHJMB-UFUCKMQHSA-N |
| XLogP | 4.76 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|