C29H41N3O4 — CID 130454081
methyl 3-[3-[(2R)-1-methoxypropan-2-yl]oxyphenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate (PubChem CID 130454081) has the molecular formula C29H41N3O4 and a molecular weight of 495.66 g/mol. Its IUPAC name is methyl 3-[3-[(2R)-1-methoxypropan-2-yl]oxyphenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate.
| Compound Name | methyl 3-[3-[(2R)-1-methoxypropan-2-yl]oxyphenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 130454081 |
| Molecular Formula | C29H41N3O4 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | methyl 3-[3-[(2R)-1-methoxypropan-2-yl]oxyphenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
| SMILES | COC[C@@H](C)Oc1cccc(C(CC(=O)OC)CN2CC[C@@H](CCc3ccc4c(n3)NCCC4)C2)c1 |
| InChI | InChI=1S/C29H41N3O4/c1-21(20-34-2)36-27-8-4-6-24(16-27)25(17-28(33)35-3)19-32-15-13-22(18-32)9-11-26-12-10-23-7-5-14-30-29(23)31-26/h4,6,8,10,12,16,21-22,25H,5,7,9,11,13-15,17-20H2,1-3H3,(H,30,31)/t21-,22-,25?/m1/s1 |
| InChIKey | OLQYBCYAPGBBSV-QQMHWKEJSA-N |
| XLogP | 4.45 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |