C32H43N5O2 — CID 134279846
tert-butyl 3-[3-(3-methylpyrazol-1-yl)phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate (PubChem CID 134279846) has the molecular formula C32H43N5O2 and a molecular weight of 529.73 g/mol. Its IUPAC name is tert-butyl 3-[3-(3-methylpyrazol-1-yl)phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate.
| Compound Name | tert-butyl 3-[3-(3-methylpyrazol-1-yl)phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 134279846 |
| Molecular Formula | C32H43N5O2 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | tert-butyl 3-[3-(3-methylpyrazol-1-yl)phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
| SMILES | Cc1ccn(-c2cccc(C(CC(=O)OC(C)(C)C)CN3CC[C@@H](CCc4ccc5c(n4)NCCC5)C3)c2)n1 |
| InChI | InChI=1S/C32H43N5O2/c1-23-14-18-37(35-23)29-9-5-7-26(19-29)27(20-30(38)39-32(2,3)4)22-36-17-15-24(21-36)10-12-28-13-11-25-8-6-16-33-31(25)34-28/h5,7,9,11,13-14,18-19,24,27H,6,8,10,12,15-17,20-22H2,1-4H3,(H,33,34)/t24-,27?/m1/s1 |
| InChIKey | MWUIIRLEFDZHKB-DXDQHDRFSA-N |
| XLogP | 5.70 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |