C30H41N3O4 — CID 130454038
methyl 3-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate (PubChem CID 130454038) has the molecular formula C30H41N3O4 and a molecular weight of 507.68 g/mol. Its IUPAC name is methyl 3-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate.
| Compound Name | methyl 3-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 130454038 |
| Molecular Formula | C30H41N3O4 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | methyl 3-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
| SMILES | COC(=O)CC(CN1CC[C@@H](CCc2ccc3c(n2)NCCC3)C1)c1cccc(OC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C30H41N3O4/c1-35-29(34)18-25(24-5-2-7-27(17-24)37-21-28-8-4-16-36-28)20-33-15-13-22(19-33)9-11-26-12-10-23-6-3-14-31-30(23)32-26/h2,5,7,10,12,17,22,25,28H,3-4,6,8-9,11,13-16,18-21H2,1H3,(H,31,32)/t22-,25?,28+/m1/s1 |
| InChIKey | ZLOGFCCUXQGXBB-IHCHDWFBSA-N |
| XLogP | 4.60 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |