C31H42BrN5O2 — CID 178049787
methyl (3S)-3-[3-bromo-5-(2,3,5-trimethyl-3H-pyrazol-1-yl)phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate (PubChem CID 178049787) has the molecular formula C31H42BrN5O2 and a molecular weight of 596.61 g/mol. Its IUPAC name is methyl (3S)-3-[3-bromo-5-(2,3,5-trimethyl-3H-pyrazol-1-yl)phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate.
| Compound Name | methyl (3S)-3-[3-bromo-5-(2,3,5-trimethyl-3H-pyrazol-1-yl)phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 178049787 |
| Molecular Formula | C31H42BrN5O2 |
| Molecular Weight | 596.61 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | methyl (3S)-3-[3-bromo-5-(2,3,5-trimethyl-3H-pyrazol-1-yl)phenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
| SMILES | COC(=O)C[C@H](CN1CC[C@@H](CCc2ccc3c(n2)NCCC3)C1)c1cc(Br)cc(N2C(C)=CC(C)N2C)c1 |
| InChI | InChI=1S/C31H42BrN5O2/c1-21-14-22(2)37(35(21)3)29-16-25(15-27(32)18-29)26(17-30(38)39-4)20-36-13-11-23(19-36)7-9-28-10-8-24-6-5-12-33-31(24)34-28/h8,10,14-16,18,21,23,26H,5-7,9,11-13,17,19-20H2,1-4H3,(H,33,34)/t21?,23-,26-/m1/s1 |
| InChIKey | BJMLTNDFZCUWTC-MMZZDGEESA-N |
| XLogP | 5.76 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |