C29H39BrN4O3 — CID 118978119
methyl (3R)-3-(3-bromo-5-morpholin-4-ylphenyl)-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate (PubChem CID 118978119) has the molecular formula C29H39BrN4O3 and a molecular weight of 571.56 g/mol. Its IUPAC name is methyl (3R)-3-(3-bromo-5-morpholin-4-ylphenyl)-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate.
| Compound Name | methyl (3R)-3-(3-bromo-5-morpholin-4-ylphenyl)-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 118978119 |
| Molecular Formula | C29H39BrN4O3 |
| Molecular Weight | 571.56 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | methyl (3R)-3-(3-bromo-5-morpholin-4-ylphenyl)-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
| SMILES | COC(=O)C[C@@H](CN1CCC(CCc2ccc3c(n2)NCCC3)C1)c1cc(Br)cc(N2CCOCC2)c1 |
| InChI | InChI=1S/C29H39BrN4O3/c1-36-28(35)17-24(23-15-25(30)18-27(16-23)34-11-13-37-14-12-34)20-33-10-8-21(19-33)4-6-26-7-5-22-3-2-9-31-29(22)32-26/h5,7,15-16,18,21,24H,2-4,6,8-14,17,19-20H2,1H3,(H,31,32)/t21?,24-/m0/s1 |
| InChIKey | GBLWEXXNMXCXPF-FHZUCYEKSA-N |
| XLogP | 4.64 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |