C34H47N7O2 — CID 171807669
methyl (3R)-3-[3-(3,5-dimethylpyrazol-1-yl)-5-piperazin-1-ylphenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate (PubChem CID 171807669) has the molecular formula C34H47N7O2 and a molecular weight of 585.80 g/mol. Its IUPAC name is methyl (3R)-3-[3-(3,5-dimethylpyrazol-1-yl)-5-piperazin-1-ylphenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate.
| Compound Name | methyl (3R)-3-[3-(3,5-dimethylpyrazol-1-yl)-5-piperazin-1-ylphenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 171807669 |
| Molecular Formula | C34H47N7O2 |
| Molecular Weight | 585.80 g/mol |
| Exact Mass | 585.38 |
| IUPAC Name | methyl (3R)-3-[3-(3,5-dimethylpyrazol-1-yl)-5-piperazin-1-ylphenyl]-4-[(3R)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
| SMILES | COC(=O)C[C@@H](CN1CC[C@@H](CCc2ccc3c(n2)NCCC3)C1)c1cc(N2CCNCC2)cc(-n2nc(C)cc2C)c1 |
| InChI | InChI=1S/C34H47N7O2/c1-24-17-25(2)41(38-24)32-19-28(18-31(21-32)40-15-12-35-13-16-40)29(20-33(42)43-3)23-39-14-10-26(22-39)6-8-30-9-7-27-5-4-11-36-34(27)37-30/h7,9,17-19,21,26,29,35H,4-6,8,10-16,20,22-23H2,1-3H3,(H,36,37)/t26-,29+/m1/s1 |
| InChIKey | GTFVKHKDYFBZPI-UHSQPCAPSA-N |
| XLogP | 4.25 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.80 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |