C30H43N3O4 — CID 130454065
methyl 3-[3-(1-methoxy-2-methylpropan-2-yl)oxyphenyl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate (PubChem CID 130454065) has the molecular formula C30H43N3O4 and a molecular weight of 509.69 g/mol. Its IUPAC name is methyl 3-[3-(1-methoxy-2-methylpropan-2-yl)oxyphenyl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate.
| Compound Name | methyl 3-[3-(1-methoxy-2-methylpropan-2-yl)oxyphenyl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 130454065 |
| Molecular Formula | C30H43N3O4 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | methyl 3-[3-(1-methoxy-2-methylpropan-2-yl)oxyphenyl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
| SMILES | COCC(C)(C)Oc1cccc(C(CC(=O)OC)CN2CCC(CCc3ccc4c(n3)NCCC4)C2)c1 |
| InChI | InChI=1S/C30H43N3O4/c1-30(2,21-35-3)37-27-9-5-7-24(17-27)25(18-28(34)36-4)20-33-16-14-22(19-33)10-12-26-13-11-23-8-6-15-31-29(23)32-26/h5,7,9,11,13,17,22,25H,6,8,10,12,14-16,18-21H2,1-4H3,(H,31,32) |
| InChIKey | DWQGLWUMPWFEKX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |