C35H49N5O2 — CID 134279844
tert-butyl 3-[3-(3,5-diethylpyrazol-1-yl)phenyl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate (PubChem CID 134279844) has the molecular formula C35H49N5O2 and a molecular weight of 571.81 g/mol. Its IUPAC name is tert-butyl 3-[3-(3,5-diethylpyrazol-1-yl)phenyl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate.
| Compound Name | tert-butyl 3-[3-(3,5-diethylpyrazol-1-yl)phenyl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 134279844 |
| Molecular Formula | C35H49N5O2 |
| Molecular Weight | 571.81 g/mol |
| Exact Mass | 571.39 |
| IUPAC Name | tert-butyl 3-[3-(3,5-diethylpyrazol-1-yl)phenyl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoate |
| SMILES | CCc1cc(CC)n(-c2cccc(C(CC(=O)OC(C)(C)C)CN3CCC(CCc4ccc5c(n4)NCCC5)C3)c2)n1 |
| InChI | InChI=1S/C35H49N5O2/c1-6-29-22-31(7-2)40(38-29)32-12-8-10-27(20-32)28(21-33(41)42-35(3,4)5)24-39-19-17-25(23-39)13-15-30-16-14-26-11-9-18-36-34(26)37-30/h8,10,12,14,16,20,22,25,28H,6-7,9,11,13,15,17-19,21,23-24H2,1-5H3,(H,36,37) |
| InChIKey | MQXCRYFHGCCTKU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.81 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |