C29H37N5NaO2 — CID 131985433
CID 131985433 (PubChem CID 131985433) has the molecular formula C29H37N5NaO2 and a molecular weight of 510.64 g/mol.
| Compound Name | CID 131985433 |
|---|---|
| PubChem CID | 131985433 |
| Molecular Formula | C29H37N5NaO2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | — |
| SMILES | Cc1nc(-c2cccc([C@H](CC(=O)O)CN3CC[C@@H](CCc4ccc5c(n4)NCCC5)C3)c2)c(C)[nH]1.[Na] |
| InChI | InChI=1S/C29H37N5O2.Na/c1-19-28(32-20(2)31-19)24-6-3-5-23(15-24)25(16-27(35)36)18-34-14-12-21(17-34)8-10-26-11-9-22-7-4-13-30-29(22)33-26;/h3,5-6,9,11,15,21,25H,4,7-8,10,12-14,16-18H2,1-2H3,(H,30,33)(H,31,32)(H,35,36);/t21-,25-;/m1./s1 |
| InChIKey | ZHFSHLWBUQJWCI-UPWLLONGSA-N |
| XLogP | 4.58 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |