C27H40N6O2 — CID 145050309
3-[3-[amino(ethenyl)amino]phenyl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid;methanamine (PubChem CID 145050309) has the molecular formula C27H40N6O2 and a molecular weight of 480.66 g/mol. Its IUPAC name is 3-[3-[amino(ethenyl)amino]phenyl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid;methanamine.
| Compound Name | 3-[3-[amino(ethenyl)amino]phenyl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid;methanamine |
|---|---|
| PubChem CID | 145050309 |
| Molecular Formula | C27H40N6O2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 3-[3-[amino(ethenyl)amino]phenyl]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]butanoic acid;methanamine |
| SMILES | C=CN(N)c1cccc(C(CC(=O)O)CN2CCC(CCc3ccc4c(n3)NCCC4)C2)c1.CN |
| InChI | InChI=1S/C26H35N5O2.CH5N/c1-2-31(27)24-7-3-5-21(15-24)22(16-25(32)33)18-30-14-12-19(17-30)8-10-23-11-9-20-6-4-13-28-26(20)29-23;1-2/h2-3,5,7,9,11,15,19,22H,1,4,6,8,10,12-14,16-18,27H2,(H,28,29)(H,32,33);2H2,1H3 |
| InChIKey | WRMQRVGLBQLLHF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|