C37H53N3O8S — CID 143097255
methyl 3-[4-[2-[2-(2-acetylsulfanylethoxy)ethoxy]ethoxy]-3-methoxyphenyl]-4-[(2S)-2-methyl-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoyl]piperidin-4-yl]butanoate (PubChem CID 143097255) has the molecular formula C37H53N3O8S and a molecular weight of 699.91 g/mol. Its IUPAC name is methyl 3-[4-[2-[2-(2-acetylsulfanylethoxy)ethoxy]ethoxy]-3-methoxyphenyl]-4-[(2S)-2-methyl-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoyl]piperidin-4-yl]butanoate.
| Compound Name | methyl 3-[4-[2-[2-(2-acetylsulfanylethoxy)ethoxy]ethoxy]-3-methoxyphenyl]-4-[(2S)-2-methyl-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoyl]piperidin-4-yl]butanoate |
|---|---|
| PubChem CID | 143097255 |
| Molecular Formula | C37H53N3O8S |
| Molecular Weight | 699.91 g/mol |
| Exact Mass | 699.36 |
| IUPAC Name | methyl 3-[4-[2-[2-(2-acetylsulfanylethoxy)ethoxy]ethoxy]-3-methoxyphenyl]-4-[(2S)-2-methyl-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propanoyl]piperidin-4-yl]butanoate |
| SMILES | COC(=O)CC(CC1CCN(C(=O)CCc2ccc3c(n2)NCCC3)[C@@H](C)C1)c1ccc(OCCOCCOCCSC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C37H53N3O8S/c1-26-22-28(13-15-40(26)35(42)12-10-32-9-7-29-6-5-14-38-37(29)39-32)23-31(25-36(43)45-4)30-8-11-33(34(24-30)44-3)48-19-18-46-16-17-47-20-21-49-27(2)41/h7-9,11,24,26,28,31H,5-6,10,12-23,25H2,1-4H3,(H,38,39)/t26-,28?,31?/m0/s1 |
| InChIKey | UOIFRJIILBPFFO-XDIJHLLGSA-N |
| XLogP | 5.44 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.91 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|