C28H36F3N3O2 — CID 42606702
methyl 4-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidin-4-yl]-3-[3-(trifluoromethyl)phenyl]butanoate (PubChem CID 42606702) has the molecular formula C28H36F3N3O2 and a molecular weight of 503.61 g/mol. Its IUPAC name is methyl 4-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidin-4-yl]-3-[3-(trifluoromethyl)phenyl]butanoate.
| Compound Name | methyl 4-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidin-4-yl]-3-[3-(trifluoromethyl)phenyl]butanoate |
|---|---|
| PubChem CID | 42606702 |
| Molecular Formula | C28H36F3N3O2 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | methyl 4-[1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidin-4-yl]-3-[3-(trifluoromethyl)phenyl]butanoate |
| SMILES | COC(=O)CC(CC1CCN(CCCc2ccc3c(n2)NCCC3)CC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H36F3N3O2/c1-36-26(35)19-23(22-5-2-7-24(18-22)28(29,30)31)17-20-11-15-34(16-12-20)14-4-8-25-10-9-21-6-3-13-32-27(21)33-25/h2,5,7,9-10,18,20,23H,3-4,6,8,11-17,19H2,1H3,(H,32,33) |
| InChIKey | WWTMRYJMHRFTKS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |