C28H35N3O4 — CID 57008370
ethyl (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-3-[2-oxo-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrrolidin-1-yl]propanoate (PubChem CID 57008370) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is ethyl (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-3-[2-oxo-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrrolidin-1-yl]propanoate.
| Compound Name | ethyl (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-3-[2-oxo-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrrolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 57008370 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | ethyl (2S)-2-(2,3-dihydro-1-benzofuran-6-yl)-3-[2-oxo-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrrolidin-1-yl]propanoate |
| SMILES | CCOC(=O)[C@H](CN1CCC(CCCc2ccc3c(n2)NCCC3)C1=O)c1ccc2c(c1)OCC2 |
| InChI | InChI=1S/C28H35N3O4/c1-2-34-28(33)24(22-9-8-19-13-16-35-25(19)17-22)18-31-15-12-21(27(31)32)5-3-7-23-11-10-20-6-4-14-29-26(20)30-23/h8-11,17,21,24H,2-7,12-16,18H2,1H3,(H,29,30)/t21?,24-/m1/s1 |
| InChIKey | YZMBKSXZMIZDLE-MQNHUJCZSA-N |
| XLogP | 3.89 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |